C17H16ClN5O2 — CID 166201798
2-(2-chlorophenyl)-2-methyl-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanehydrazide (PubChem CID 166201798) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-methyl-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanehydrazide.
| Compound Name | 2-(2-chlorophenyl)-2-methyl-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanehydrazide |
|---|---|
| PubChem CID | 166201798 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(2-chlorophenyl)-2-methyl-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanehydrazide |
| SMILES | CC(C)(C(=O)NNc1nc(-c2ccncc2)no1)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN5O2/c1-17(2,12-5-3-4-6-13(12)18)15(24)21-22-16-20-14(23-25-16)11-7-9-19-10-8-11/h3-10H,1-2H3,(H,21,24)(H,20,22,23) |
| InChIKey | AVKWIQCVUFQICJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|