C16H12N8O2S — CID 167945271
2-(pyridin-2-ylamino)-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-4-carbohydrazide (PubChem CID 167945271) has the molecular formula C16H12N8O2S and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-(pyridin-2-ylamino)-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(pyridin-2-ylamino)-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 167945271 |
| Molecular Formula | C16H12N8O2S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-(pyridin-2-ylamino)-N'-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccncc2)no1)c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C16H12N8O2S/c25-14(11-9-27-16(19-11)20-12-3-1-2-6-18-12)22-23-15-21-13(24-26-15)10-4-7-17-8-5-10/h1-9H,(H,22,25)(H,18,19,20)(H,21,23,24) |
| InChIKey | LDATYDVRCHNITI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|