C20H24FN3 — CID 166203914
1-(5-fluoro-2-pyridinyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]propan-1-amine (PubChem CID 166203914) has the molecular formula C20H24FN3 and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]propan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 166203914 |
| Molecular Formula | C20H24FN3 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]propan-1-amine |
| SMILES | CCC(NCc1cc(C)cc2c(C)c(C)[nH]c12)c1ccc(F)cn1 |
| InChI | InChI=1S/C20H24FN3/c1-5-18(19-7-6-16(21)11-23-19)22-10-15-8-12(2)9-17-13(3)14(4)24-20(15)17/h6-9,11,18,22,24H,5,10H2,1-4H3 |
| InChIKey | BCJTVAHUZICVHW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|