C14H18N4O4 — CID 166205114
(1-methyltetrazol-5-yl)methyl 3,4-diethoxybenzoate (PubChem CID 166205114) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (1-methyltetrazol-5-yl)methyl 3,4-diethoxybenzoate.
| Compound Name | (1-methyltetrazol-5-yl)methyl 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 166205114 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (1-methyltetrazol-5-yl)methyl 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCc2nnnn2C)cc1OCC |
| InChI | InChI=1S/C14H18N4O4/c1-4-20-11-7-6-10(8-12(11)21-5-2)14(19)22-9-13-15-16-17-18(13)3/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | RBGNYZZBIGURAY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |