C20H26N2O3S2 — CID 166207254
N-[2-[5-[2-[(2-methylphenyl)methyl]pyrrolidin-1-yl]sulfonylthiophen-2-yl]ethyl]acetamide (PubChem CID 166207254) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[2-[5-[2-[(2-methylphenyl)methyl]pyrrolidin-1-yl]sulfonylthiophen-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[5-[2-[(2-methylphenyl)methyl]pyrrolidin-1-yl]sulfonylthiophen-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 166207254 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[2-[5-[2-[(2-methylphenyl)methyl]pyrrolidin-1-yl]sulfonylthiophen-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(S(=O)(=O)N2CCCC2Cc2ccccc2C)s1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-15-6-3-4-7-17(15)14-18-8-5-13-22(18)27(24,25)20-10-9-19(26-20)11-12-21-16(2)23/h3-4,6-7,9-10,18H,5,8,11-14H2,1-2H3,(H,21,23) |
| InChIKey | XKQQTCQVLKOWRK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |