C25H22F3N3O4 — CID 166208185
(1'R,4S)-N-[2-(pyridin-4-ylamino)phenyl]spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166208185) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is (1'R,4S)-N-[2-(pyridin-4-ylamino)phenyl]spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1'R,4S)-N-[2-(pyridin-4-ylamino)phenyl]spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166208185 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (1'R,4S)-N-[2-(pyridin-4-ylamino)phenyl]spiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccccc1Nc1ccncc1)[C@@H]1C[C@]12CCOc1ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H21N3O2.C2HF3O2/c27-22(18-15-23(18)11-14-28-21-8-4-1-5-17(21)23)26-20-7-3-2-6-19(20)25-16-9-12-24-13-10-16;3-2(4,5)1(6)7/h1-10,12-13,18H,11,14-15H2,(H,24,25)(H,26,27);(H,6,7)/t18-,23-;/m0./s1 |
| InChIKey | KDMJHQDZYGXXDK-JCNFZFLDSA-N |
| XLogP | 5.14 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |