C19H25NO4S — CID 166208401
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] thiane-2-carboxylate (PubChem CID 166208401) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] thiane-2-carboxylate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] thiane-2-carboxylate |
|---|---|
| PubChem CID | 166208401 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] thiane-2-carboxylate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)C2CCCCS2)cc1 |
| InChI | InChI=1S/C19H25NO4S/c1-13(2)11-18(22)20-15-8-6-14(7-9-15)16(21)12-24-19(23)17-5-3-4-10-25-17/h6-9,13,17H,3-5,10-12H2,1-2H3,(H,20,22) |
| InChIKey | NAIATJPVNZLOAL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |