C19H31F3N2O5 — CID 166208818
5-[3-(cyclohexylcarbamoyl)piperidin-1-yl]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166208818) has the molecular formula C19H31F3N2O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-[3-(cyclohexylcarbamoyl)piperidin-1-yl]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[3-(cyclohexylcarbamoyl)piperidin-1-yl]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166208818 |
| Molecular Formula | C19H31F3N2O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 5-[3-(cyclohexylcarbamoyl)piperidin-1-yl]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCCCN1CCCC(C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C17H30N2O3.C2HF3O2/c20-16(21)10-4-5-11-19-12-6-7-14(13-19)17(22)18-15-8-2-1-3-9-15;3-2(4,5)1(6)7/h14-15H,1-13H2,(H,18,22)(H,20,21);(H,6,7) |
| InChIKey | RXQLTORRXOARBN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|