C17H14F3N3O2 — CID 166208993
2-[3-cyano-4-[4-(trifluoromethyl)phenoxy]anilino]propanamide (PubChem CID 166208993) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-[3-cyano-4-[4-(trifluoromethyl)phenoxy]anilino]propanamide.
| Compound Name | 2-[3-cyano-4-[4-(trifluoromethyl)phenoxy]anilino]propanamide |
|---|---|
| PubChem CID | 166208993 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[3-cyano-4-[4-(trifluoromethyl)phenoxy]anilino]propanamide |
| SMILES | CC(Nc1ccc(Oc2ccc(C(F)(F)F)cc2)c(C#N)c1)C(N)=O |
| InChI | InChI=1S/C17H14F3N3O2/c1-10(16(22)24)23-13-4-7-15(11(8-13)9-21)25-14-5-2-12(3-6-14)17(18,19)20/h2-8,10,23H,1H3,(H2,22,24) |
| InChIKey | SYAJUXJMFRPRHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |