C18H16F3N3O2 — CID 60583084
2-[4-(2-cyanophenoxy)anilino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 60583084) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[4-(2-cyanophenoxy)anilino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[4-(2-cyanophenoxy)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 60583084 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[4-(2-cyanophenoxy)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Nc1ccc(Oc2ccccc2C#N)cc1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O2/c1-12(17(25)23-11-18(19,20)21)24-14-6-8-15(9-7-14)26-16-5-3-2-4-13(16)10-22/h2-9,12,24H,11H2,1H3,(H,23,25) |
| InChIKey | XJPABMQXGZYYLQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |