C12H10ClF3N2O2 — CID 99830335
(2R)-2-(3-chloro-4-cyanophenoxy)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 99830335) has the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-cyanophenoxy)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2R)-2-(3-chloro-4-cyanophenoxy)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 99830335 |
| Molecular Formula | C12H10ClF3N2O2 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2R)-2-(3-chloro-4-cyanophenoxy)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(C#N)c(Cl)c1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H10ClF3N2O2/c1-7(11(19)18-6-12(14,15)16)20-9-3-2-8(5-17)10(13)4-9/h2-4,7H,6H2,1H3,(H,18,19)/t7-/m1/s1 |
| InChIKey | BTNVLDNRZMGHBL-SSDOTTSWSA-N |
| XLogP | 2.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |