C17H17N3O2 — CID 166212065
N-(5-ethyl-1,2-oxazol-3-yl)-2,6-dimethylquinoline-4-carboxamide (PubChem CID 166212065) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(5-ethyl-1,2-oxazol-3-yl)-2,6-dimethylquinoline-4-carboxamide.
| Compound Name | N-(5-ethyl-1,2-oxazol-3-yl)-2,6-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 166212065 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-(5-ethyl-1,2-oxazol-3-yl)-2,6-dimethylquinoline-4-carboxamide |
| SMILES | CCc1cc(NC(=O)c2cc(C)nc3ccc(C)cc23)no1 |
| InChI | InChI=1S/C17H17N3O2/c1-4-12-9-16(20-22-12)19-17(21)14-8-11(3)18-15-6-5-10(2)7-13(14)15/h5-9H,4H2,1-3H3,(H,19,20,21) |
| InChIKey | CSDWRUADILHOEX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |