C19H21N3O4S — CID 166215063
N-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-N'-(2-methylphenyl)oxamide (PubChem CID 166215063) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 166215063 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-14-5-2-3-6-17(14)21-19(24)18(23)20-13-15-7-9-16(10-8-15)22-11-4-12-27(22,25)26/h2-3,5-10H,4,11-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | UWURIAXZOYYESY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|