C15H16FN3O3 — CID 166216968
N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-3-(3-fluorophenyl)butanamide (PubChem CID 166216968) has the molecular formula C15H16FN3O3 and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-3-(3-fluorophenyl)butanamide.
| Compound Name | N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-3-(3-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 166216968 |
| Molecular Formula | C15H16FN3O3 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-3-(3-fluorophenyl)butanamide |
| SMILES | CC(CC(=O)NCc1c[nH]c(=O)[nH]c1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H16FN3O3/c1-9(10-3-2-4-12(16)6-10)5-13(20)17-7-11-8-18-15(22)19-14(11)21/h2-4,6,8-9H,5,7H2,1H3,(H,17,20)(H2,18,19,21,22) |
| InChIKey | OEFYTZVXCYGYNX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |