C17H16N4O2S — CID 166219839
5-cyclopropyl-N-[2-(1H-indazol-6-ylamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 166219839) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-(1H-indazol-6-ylamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[2-(1H-indazol-6-ylamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166219839 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-cyclopropyl-N-[2-(1H-indazol-6-ylamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(C2CC2)s1)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C17H16N4O2S/c22-16(20-12-4-3-11-8-19-21-13(11)7-12)9-18-17(23)15-6-5-14(24-15)10-1-2-10/h3-8,10H,1-2,9H2,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | ZWXURUQDYPXEII-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |