C18H12ClF3N4O — CID 166220560
(Z)-3-(4-chlorophenyl)-4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]but-2-enamide (PubChem CID 166220560) has the molecular formula C18H12ClF3N4O and a molecular weight of 392.77 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]but-2-enamide.
| Compound Name | (Z)-3-(4-chlorophenyl)-4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 166220560 |
| Molecular Formula | C18H12ClF3N4O |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)phenyl]but-2-enamide |
| SMILES | O=C(/C=C(/c1ccc(Cl)cc1)C(F)(F)F)Nc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C18H12ClF3N4O/c19-13-6-4-11(5-7-13)15(18(20,21)22)9-16(27)25-14-3-1-2-12(8-14)17-23-10-24-26-17/h1-10H,(H,25,27)(H,23,24,26)/b15-9- |
| InChIKey | WAJOGEHXANDYDE-DHDCSXOGSA-N |
| XLogP | 4.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|