C20H22N4O2 — CID 86815500
tert-butyl 4-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]benzoate (PubChem CID 86815500) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl 4-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]benzoate.
| Compound Name | tert-butyl 4-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 86815500 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | tert-butyl 4-[[3-(1H-1,2,4-triazol-5-yl)anilino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CNc2cccc(-c3ncn[nH]3)c2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-20(2,3)26-19(25)15-9-7-14(8-10-15)12-21-17-6-4-5-16(11-17)18-22-13-23-24-18/h4-11,13,21H,12H2,1-3H3,(H,22,23,24) |
| InChIKey | BYYJPNMSWJRTBF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |