C18H19N5 — CID 167890883
N-[[4-(azetidin-1-yl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)aniline (PubChem CID 167890883) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is N-[[4-(azetidin-1-yl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)aniline.
| Compound Name | N-[[4-(azetidin-1-yl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)aniline |
|---|---|
| PubChem CID | 167890883 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[[4-(azetidin-1-yl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)aniline |
| SMILES | c1cc(NCc2ccc(N3CCC3)cc2)cc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C18H19N5/c1-3-15(18-20-13-21-22-18)11-16(4-1)19-12-14-5-7-17(8-6-14)23-9-2-10-23/h1,3-8,11,13,19H,2,9-10,12H2,(H,20,21,22) |
| InChIKey | VRBRRCMFDFUNJJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|