C22H23NO5S — CID 166221599
2,6-dimethoxy-N-[[4-(4-methoxyphenyl)phenyl]methyl]benzenesulfonamide (PubChem CID 166221599) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[[4-(4-methoxyphenyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,6-dimethoxy-N-[[4-(4-methoxyphenyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166221599 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2,6-dimethoxy-N-[[4-(4-methoxyphenyl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2ccc(CNS(=O)(=O)c3c(OC)cccc3OC)cc2)cc1 |
| InChI | InChI=1S/C22H23NO5S/c1-26-19-13-11-18(12-14-19)17-9-7-16(8-10-17)15-23-29(24,25)22-20(27-2)5-4-6-21(22)28-3/h4-14,23H,15H2,1-3H3 |
| InChIKey | STTVPBQVBOORON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |