C21H21NO3 — CID 166224157
(2-pyridin-3-ylcyclopentyl) (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate (PubChem CID 166224157) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2-pyridin-3-ylcyclopentyl) (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate.
| Compound Name | (2-pyridin-3-ylcyclopentyl) (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 166224157 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2-pyridin-3-ylcyclopentyl) (E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCO2)OC1CCCC1c1cccnc1 |
| InChI | InChI=1S/C21H21NO3/c23-21(9-7-15-6-8-19-16(13-15)10-12-24-19)25-20-5-1-4-18(20)17-3-2-11-22-14-17/h2-3,6-9,11,13-14,18,20H,1,4-5,10,12H2/b9-7+ |
| InChIKey | MCFHLUDWKFTLQX-VQHVLOKHSA-N |
| XLogP | 3.91 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|