C17H20ClN3O4S — CID 166225600
1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-[[2-(methanesulfonamido)phenyl]methyl]urea (PubChem CID 166225600) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-[[2-(methanesulfonamido)phenyl]methyl]urea.
| Compound Name | 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-[[2-(methanesulfonamido)phenyl]methyl]urea |
|---|---|
| PubChem CID | 166225600 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-[(2S)-2-(4-chlorophenyl)-2-hydroxyethyl]-3-[[2-(methanesulfonamido)phenyl]methyl]urea |
| SMILES | CS(=O)(=O)Nc1ccccc1CNC(=O)NC[C@@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClN3O4S/c1-26(24,25)21-15-5-3-2-4-13(15)10-19-17(23)20-11-16(22)12-6-8-14(18)9-7-12/h2-9,16,21-22H,10-11H2,1H3,(H2,19,20,23)/t16-/m1/s1 |
| InChIKey | IGVGSMBJOLCKAE-MRXNPFEDSA-N |
| XLogP | 2.24 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |