C16H23N5O3S — CID 51124441
1-[[2-(methanesulfonamido)phenyl]methyl]-3-(2-methyl-3-pyrazol-1-ylpropyl)urea (PubChem CID 51124441) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 1-[[2-(methanesulfonamido)phenyl]methyl]-3-(2-methyl-3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[[2-(methanesulfonamido)phenyl]methyl]-3-(2-methyl-3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 51124441 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[[2-(methanesulfonamido)phenyl]methyl]-3-(2-methyl-3-pyrazol-1-ylpropyl)urea |
| SMILES | CC(CNC(=O)NCc1ccccc1NS(C)(=O)=O)Cn1cccn1 |
| InChI | InChI=1S/C16H23N5O3S/c1-13(12-21-9-5-8-19-21)10-17-16(22)18-11-14-6-3-4-7-15(14)20-25(2,23)24/h3-9,13,20H,10-12H2,1-2H3,(H2,17,18,22) |
| InChIKey | YBCSCKKVZNQPAE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |