C22H30N6O4 — CID 166227497
1-N,1-N'-bis[1-(oxolan-3-ylmethyl)pyrazol-3-yl]cyclobutane-1,1-dicarboxamide (PubChem CID 166227497) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-N,1-N'-bis[1-(oxolan-3-ylmethyl)pyrazol-3-yl]cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis[1-(oxolan-3-ylmethyl)pyrazol-3-yl]cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 166227497 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 1-N,1-N'-bis[1-(oxolan-3-ylmethyl)pyrazol-3-yl]cyclobutane-1,1-dicarboxamide |
| SMILES | O=C(Nc1ccn(CC2CCOC2)n1)C1(C(=O)Nc2ccn(CC3CCOC3)n2)CCC1 |
| InChI | InChI=1S/C22H30N6O4/c29-20(23-18-2-8-27(25-18)12-16-4-10-31-14-16)22(6-1-7-22)21(30)24-19-3-9-28(26-19)13-17-5-11-32-15-17/h2-3,8-9,16-17H,1,4-7,10-15H2,(H,23,25,29)(H,24,26,30) |
| InChIKey | BCTAEGMGWNYVLY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|