C18H21ClFNO3S — CID 166227994
(2S)-2-(4-chlorophenoxy)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propan-1-amine (PubChem CID 166227994) has the molecular formula C18H21ClFNO3S and a molecular weight of 385.89 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propan-1-amine.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 166227994 |
| Molecular Formula | C18H21ClFNO3S |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]propan-1-amine |
| SMILES | CC(NC[C@H](C)Oc1ccc(Cl)cc1)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C18H21ClFNO3S/c1-12(24-16-7-5-15(19)6-8-16)11-21-13(2)14-4-9-18(17(20)10-14)25(3,22)23/h4-10,12-13,21H,11H2,1-3H3/t12-,13?/m0/s1 |
| InChIKey | OMSDWXQOFQSGSX-UEWDXFNNSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |