About N-dodecyl-N'-(thiadiazol-5-yl)oxamide
N-dodecyl-N'-(thiadiazol-5-yl)oxamide (PubChem CID 166228092) has the molecular formula C16H28N4O2S
and a molecular weight of 340.49 g/mol. Its IUPAC name is N-dodecyl-N'-(thiadiazol-5-yl)oxamide.
Molecular Properties
| Compound Name | N-dodecyl-N'-(thiadiazol-5-yl)oxamide |
| PubChem CID | 166228092 |
| Molecular Formula | C16H28N4O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-dodecyl-N'-(thiadiazol-5-yl)oxamide |
| SMILES | CCCCCCCCCCCCNC(=O)C(=O)Nc1cnns1 |
| InChI | InChI=1S/C16H28N4O2S/c1-2-3-4-5-6-7-8-9-10-11-12-17-15(21)16(22)19-14-13-18-20-23-14/h13H,2-12H2,1H3,(H,17,21)(H,19,22) |
| InChIKey | YFDFFWXLUZXOKR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-dodecyl-N'-(thiadiazol-5-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dodecyl-N'-(thiadiazol-5-yl)oxamide?
The IUPAC name of N-dodecyl-N'-(thiadiazol-5-yl)oxamide (CID 166228092) is N-dodecyl-N'-(thiadiazol-5-yl)oxamide.
What is the SMILES notation for N-dodecyl-N'-(thiadiazol-5-yl)oxamide?
The canonical SMILES for N-dodecyl-N'-(thiadiazol-5-yl)oxamide is CCCCCCCCCCCCNC(=O)C(=O)Nc1cnns1.
What is the InChIKey of N-dodecyl-N'-(thiadiazol-5-yl)oxamide?
The InChIKey is YFDFFWXLUZXOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O2S/c1-2-3-4-5-6-7-8-9-10-11-12-17-15(21)16(22)19-14-13-18-20-23-14/h13H,2-12H2,1H3,(H,17,21)(H,19,22).
What are the key properties of N-dodecyl-N'-(thiadiazol-5-yl)oxamide?
N-dodecyl-N'-(thiadiazol-5-yl)oxamide has a molecular weight of 340.49 g/mol, XLogP of 3.51, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-dodecyl-N'-(thiadiazol-5-yl)oxamide is sourced from PubChem (CID 166228092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).