C18H18N2O4 — CID 166230623
N-[2-[4-(cyanomethyl)phenoxy]ethyl]-2-hydroxy-3-methoxybenzamide (PubChem CID 166230623) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-[2-[4-(cyanomethyl)phenoxy]ethyl]-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-[2-[4-(cyanomethyl)phenoxy]ethyl]-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 166230623 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[2-[4-(cyanomethyl)phenoxy]ethyl]-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCOc2ccc(CC#N)cc2)c1O |
| InChI | InChI=1S/C18H18N2O4/c1-23-16-4-2-3-15(17(16)21)18(22)20-11-12-24-14-7-5-13(6-8-14)9-10-19/h2-8,21H,9,11-12H2,1H3,(H,20,22) |
| InChIKey | PLOGSUZDIZOLHX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|