C22H19NO5S — CID 166231797
4-oxo-4-[3-[(2-phenylphenyl)sulfonylamino]phenyl]butanoic acid (PubChem CID 166231797) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-oxo-4-[3-[(2-phenylphenyl)sulfonylamino]phenyl]butanoic acid.
| Compound Name | 4-oxo-4-[3-[(2-phenylphenyl)sulfonylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 166231797 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-oxo-4-[3-[(2-phenylphenyl)sulfonylamino]phenyl]butanoic acid |
| SMILES | O=C(O)CCC(=O)c1cccc(NS(=O)(=O)c2ccccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C22H19NO5S/c24-20(13-14-22(25)26)17-9-6-10-18(15-17)23-29(27,28)21-12-5-4-11-19(21)16-7-2-1-3-8-16/h1-12,15,23H,13-14H2,(H,25,26) |
| InChIKey | AAOZHFPSOFWTME-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |