C16H12FN3OS — CID 166234287
(E)-1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(pyridin-3-ylmethoxy)methanimine (PubChem CID 166234287) has the molecular formula C16H12FN3OS and a molecular weight of 313.36 g/mol. Its IUPAC name is (E)-1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(pyridin-3-ylmethoxy)methanimine.
| Compound Name | (E)-1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(pyridin-3-ylmethoxy)methanimine |
|---|---|
| PubChem CID | 166234287 |
| Molecular Formula | C16H12FN3OS |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (E)-1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-(pyridin-3-ylmethoxy)methanimine |
| SMILES | Fc1ccc(-c2nc(/C=N/OCc3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C16H12FN3OS/c17-14-5-3-13(4-6-14)16-20-15(11-22-16)9-19-21-10-12-2-1-7-18-8-12/h1-9,11H,10H2/b19-9+ |
| InChIKey | INVGPQMSRIISRT-DJKKODMXSA-N |
| XLogP | 3.89 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|