C24H25N5O2 — CID 166234843
1-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(6-phenylpyridazin-3-yl)urea (PubChem CID 166234843) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 1-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(6-phenylpyridazin-3-yl)urea.
| Compound Name | 1-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(6-phenylpyridazin-3-yl)urea |
|---|---|
| PubChem CID | 166234843 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]-3-(6-phenylpyridazin-3-yl)urea |
| SMILES | O=C(NCC1CC(=O)N(CCc2ccccc2)C1)Nc1ccc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H25N5O2/c30-23-15-19(17-29(23)14-13-18-7-3-1-4-8-18)16-25-24(31)26-22-12-11-21(27-28-22)20-9-5-2-6-10-20/h1-12,19H,13-17H2,(H2,25,26,28,31) |
| InChIKey | USLULOFQHAIHHI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |