C21H28N2O2 — CID 97082046
2-(cyclohexen-1-yl)-N-[[(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 97082046) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97082046 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[(3R)-5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(CC1=CCCCC1)NC[C@H]1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2O2/c24-20(13-18-9-5-2-6-10-18)22-15-19-14-21(25)23(16-19)12-11-17-7-3-1-4-8-17/h1,3-4,7-9,19H,2,5-6,10-16H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | FYXLOOISYLOHRE-LJQANCHMSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|