C19H20N2O5 — CID 167826538
5-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methylcarbamoyl]furan-2-carboxylic acid (PubChem CID 167826538) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methylcarbamoyl]furan-2-carboxylic acid.
| Compound Name | 5-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methylcarbamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 167826538 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 5-[[5-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]methylcarbamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)NCC2CC(=O)N(CCc3ccccc3)C2)o1 |
| InChI | InChI=1S/C19H20N2O5/c22-17-10-14(12-21(17)9-8-13-4-2-1-3-5-13)11-20-18(23)15-6-7-16(26-15)19(24)25/h1-7,14H,8-12H2,(H,20,23)(H,24,25) |
| InChIKey | BBBBFCQWMUZPGG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |