About 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide
4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 166236379) has the molecular formula C17H20N4O4
and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| PubChem CID | 166236379 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)c1[nH]nc(C(N)=O)c1NC(=O)c1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C17H20N4O4/c1-9(2)12-13(14(15(18)22)21-20-12)19-16(23)10-4-3-5-11(8-10)17-24-6-7-25-17/h3-5,8-9,17H,6-7H2,1-2H3,(H2,18,22)(H,19,23)(H,20,21) |
| InChIKey | NIZANMHCHKJAIY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The IUPAC name of 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide (CID 166236379) is 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The canonical SMILES for 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide is CC(C)c1[nH]nc(C(N)=O)c1NC(=O)c1cccc(C2OCCO2)c1.
What is the InChIKey of 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide?
The InChIKey is NIZANMHCHKJAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O4/c1-9(2)12-13(14(15(18)22)21-20-12)19-16(23)10-4-3-5-11(8-10)17-24-6-7-25-17/h3-5,8-9,17H,6-7H2,1-2H3,(H2,18,22)(H,19,23)(H,20,21).
What are the key properties of 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide?
4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide has a molecular weight of 344.37 g/mol, XLogP of 1.93, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-(1,3-dioxolan-2-yl)benzoyl]amino]-5-propan-2-yl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 166236379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).