C20H21F2N3OS — CID 166237194
N-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-1-thieno[3,2-b]pyridin-6-ylethanamine (PubChem CID 166237194) has the molecular formula C20H21F2N3OS and a molecular weight of 389.47 g/mol. Its IUPAC name is N-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-1-thieno[3,2-b]pyridin-6-ylethanamine.
| Compound Name | N-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-1-thieno[3,2-b]pyridin-6-ylethanamine |
|---|---|
| PubChem CID | 166237194 |
| Molecular Formula | C20H21F2N3OS |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(3,5-difluoro-4-morpholin-4-ylphenyl)methyl]-1-thieno[3,2-b]pyridin-6-ylethanamine |
| SMILES | CC(NCc1cc(F)c(N2CCOCC2)c(F)c1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C20H21F2N3OS/c1-13(15-10-19-18(24-12-15)2-7-27-19)23-11-14-8-16(21)20(17(22)9-14)25-3-5-26-6-4-25/h2,7-10,12-13,23H,3-6,11H2,1H3 |
| InChIKey | SYAYKFWFDLVMOH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|