C17H22FN5O — CID 166237459
1-[3-(aminomethyl)cyclopentyl]-3-[1-(3-fluorophenyl)-5-methylpyrazol-3-yl]urea (PubChem CID 166237459) has the molecular formula C17H22FN5O and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-[3-(aminomethyl)cyclopentyl]-3-[1-(3-fluorophenyl)-5-methylpyrazol-3-yl]urea.
| Compound Name | 1-[3-(aminomethyl)cyclopentyl]-3-[1-(3-fluorophenyl)-5-methylpyrazol-3-yl]urea |
|---|---|
| PubChem CID | 166237459 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[3-(aminomethyl)cyclopentyl]-3-[1-(3-fluorophenyl)-5-methylpyrazol-3-yl]urea |
| SMILES | Cc1cc(NC(=O)NC2CCC(CN)C2)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H22FN5O/c1-11-7-16(22-23(11)15-4-2-3-13(18)9-15)21-17(24)20-14-6-5-12(8-14)10-19/h2-4,7,9,12,14H,5-6,8,10,19H2,1H3,(H2,20,21,22,24) |
| InChIKey | UKHQXNYYPDIBKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |