C20H23F3N8O4 — CID 166237520
1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 166237520) has the molecular formula C20H23F3N8O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166237520 |
| Molecular Formula | C20H23F3N8O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | Cn1ncc2c(NCCNC(=O)Nc3ccc4c(c3)CNCCO4)ncnc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N8O2.C2HF3O2/c1-26-17-14(10-24-26)16(22-11-23-17)20-4-5-21-18(27)25-13-2-3-15-12(8-13)9-19-6-7-28-15;3-2(4,5)1(6)7/h2-3,8,10-11,19H,4-7,9H2,1H3,(H,20,22,23)(H2,21,25,27);(H,6,7) |
| InChIKey | MGOAZLGUWDZMIR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|