C11H17N5O4S2 — CID 166239242
N-[2-(dimethylsulfamoyl)ethyl]-1-methylbenzotriazole-5-sulfonamide (PubChem CID 166239242) has the molecular formula C11H17N5O4S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-1-methylbenzotriazole-5-sulfonamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-1-methylbenzotriazole-5-sulfonamide |
|---|---|
| PubChem CID | 166239242 |
| Molecular Formula | C11H17N5O4S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-1-methylbenzotriazole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNS(=O)(=O)c1ccc2c(c1)nnn2C |
| InChI | InChI=1S/C11H17N5O4S2/c1-15(2)21(17,18)7-6-12-22(19,20)9-4-5-11-10(8-9)13-14-16(11)3/h4-5,8,12H,6-7H2,1-3H3 |
| InChIKey | HERRTGZRRQJTSH-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |