C16H16N4O4S — CID 66837875
methyl 4-[(1-methylbenzotriazol-5-yl)methylsulfamoyl]benzoate (PubChem CID 66837875) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is methyl 4-[(1-methylbenzotriazol-5-yl)methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[(1-methylbenzotriazol-5-yl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 66837875 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 4-[(1-methylbenzotriazol-5-yl)methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCc2ccc3c(c2)nnn3C)cc1 |
| InChI | InChI=1S/C16H16N4O4S/c1-20-15-8-3-11(9-14(15)18-19-20)10-17-25(22,23)13-6-4-12(5-7-13)16(21)24-2/h3-9,17H,10H2,1-2H3 |
| InChIKey | SCDFJDPOIAXHCP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |