C18H19N5O7S — CID 75395651
methyl 5-[[[2-[(1-hydroxybenzotriazol-5-yl)sulfonylamino]acetyl]amino]methyl]-2-methoxybenzoate (PubChem CID 75395651) has the molecular formula C18H19N5O7S and a molecular weight of 449.45 g/mol. Its IUPAC name is methyl 5-[[[2-[(1-hydroxybenzotriazol-5-yl)sulfonylamino]acetyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[2-[(1-hydroxybenzotriazol-5-yl)sulfonylamino]acetyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 75395651 |
| Molecular Formula | C18H19N5O7S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | methyl 5-[[[2-[(1-hydroxybenzotriazol-5-yl)sulfonylamino]acetyl]amino]methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CNC(=O)CNS(=O)(=O)c2ccc3c(c2)nnn3O)ccc1OC |
| InChI | InChI=1S/C18H19N5O7S/c1-29-16-6-3-11(7-13(16)18(25)30-2)9-19-17(24)10-20-31(27,28)12-4-5-15-14(8-12)21-22-23(15)26/h3-8,20,26H,9-10H2,1-2H3,(H,19,24) |
| InChIKey | QIRJACGKDACNLF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 161.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|