C16H18F3N3O2 — CID 166240629
N-benzyl-4,4,4-trifluoro-3-methoxy-N-(1H-pyrazol-5-ylmethyl)butanamide (PubChem CID 166240629) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-benzyl-4,4,4-trifluoro-3-methoxy-N-(1H-pyrazol-5-ylmethyl)butanamide.
| Compound Name | N-benzyl-4,4,4-trifluoro-3-methoxy-N-(1H-pyrazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 166240629 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-benzyl-4,4,4-trifluoro-3-methoxy-N-(1H-pyrazol-5-ylmethyl)butanamide |
| SMILES | COC(CC(=O)N(Cc1ccccc1)Cc1ccn[nH]1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O2/c1-24-14(16(17,18)19)9-15(23)22(11-13-7-8-20-21-13)10-12-5-3-2-4-6-12/h2-8,14H,9-11H2,1H3,(H,20,21) |
| InChIKey | ZBSRBNICXWJUAW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |