C18H20ClN5O2 — CID 166243490
N-(5-chloro-2-pyridinyl)-3-[(3-methylpyrrolidin-3-yl)carbamoylamino]benzamide (PubChem CID 166243490) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-[(3-methylpyrrolidin-3-yl)carbamoylamino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-[(3-methylpyrrolidin-3-yl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 166243490 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-[(3-methylpyrrolidin-3-yl)carbamoylamino]benzamide |
| SMILES | CC1(NC(=O)Nc2cccc(C(=O)Nc3ccc(Cl)cn3)c2)CCNC1 |
| InChI | InChI=1S/C18H20ClN5O2/c1-18(7-8-20-11-18)24-17(26)22-14-4-2-3-12(9-14)16(25)23-15-6-5-13(19)10-21-15/h2-6,9-10,20H,7-8,11H2,1H3,(H,21,23,25)(H2,22,24,26) |
| InChIKey | REWSKQGKCBXVDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |