C30H28ClN5O2 — CID 166338478
3-[(1-benzyl-3-phenylpyrrolidin-3-yl)carbamoylamino]-N-(5-chloro-2-pyridinyl)benzamide (PubChem CID 166338478) has the molecular formula C30H28ClN5O2 and a molecular weight of 526.04 g/mol. Its IUPAC name is 3-[(1-benzyl-3-phenylpyrrolidin-3-yl)carbamoylamino]-N-(5-chloro-2-pyridinyl)benzamide.
| Compound Name | 3-[(1-benzyl-3-phenylpyrrolidin-3-yl)carbamoylamino]-N-(5-chloro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 166338478 |
| Molecular Formula | C30H28ClN5O2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-[(1-benzyl-3-phenylpyrrolidin-3-yl)carbamoylamino]-N-(5-chloro-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2ccc(Cl)cn2)c1)NC1(c2ccccc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C30H28ClN5O2/c31-25-14-15-27(32-19-25)34-28(37)23-10-7-13-26(18-23)33-29(38)35-30(24-11-5-2-6-12-24)16-17-36(21-30)20-22-8-3-1-4-9-22/h1-15,18-19H,16-17,20-21H2,(H,32,34,37)(H2,33,35,38) |
| InChIKey | FSJSPARUYGTPPN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |