C16H16ClN3O5 — CID 166244484
2-[[(7-chloro-4-oxochromene-2-carbonyl)amino]methyl]morpholine-4-carboxamide (PubChem CID 166244484) has the molecular formula C16H16ClN3O5 and a molecular weight of 365.77 g/mol. Its IUPAC name is 2-[[(7-chloro-4-oxochromene-2-carbonyl)amino]methyl]morpholine-4-carboxamide.
| Compound Name | 2-[[(7-chloro-4-oxochromene-2-carbonyl)amino]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 166244484 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-[[(7-chloro-4-oxochromene-2-carbonyl)amino]methyl]morpholine-4-carboxamide |
| SMILES | NC(=O)N1CCOC(CNC(=O)c2cc(=O)c3ccc(Cl)cc3o2)C1 |
| InChI | InChI=1S/C16H16ClN3O5/c17-9-1-2-11-12(21)6-14(25-13(11)5-9)15(22)19-7-10-8-20(16(18)23)3-4-24-10/h1-2,5-6,10H,3-4,7-8H2,(H2,18,23)(H,19,22) |
| InChIKey | QAPDYFWNXWNNOM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |