C14H15NO2 — CID 166244917
2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylmethyl)prop-2-enoic acid (PubChem CID 166244917) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylmethyl)prop-2-enoic acid.
| Compound Name | 2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 166244917 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(11-azatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(CN1C2CCC1c1ccccc12)C(=O)O |
| InChI | InChI=1S/C14H15NO2/c1-9(14(16)17)8-15-12-6-7-13(15)11-5-3-2-4-10(11)12/h2-5,12-13H,1,6-8H2,(H,16,17) |
| InChIKey | SXAFWNIBNXDUJA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|