C19H19NO2 — CID 167964480
2-[(3-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]prop-2-enoic acid (PubChem CID 167964480) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[(3-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]prop-2-enoic acid.
| Compound Name | 2-[(3-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167964480 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(3-phenyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]prop-2-enoic acid |
| SMILES | C=C(CN1Cc2ccccc2CC1c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H19NO2/c1-14(19(21)22)12-20-13-17-10-6-5-9-16(17)11-18(20)15-7-3-2-4-8-15/h2-10,18H,1,11-13H2,(H,21,22) |
| InChIKey | GVECPJTXEBYDHT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|