C15H16O4 — CID 166245595
(4-acetyl-3-methylphenyl) (1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 166245595) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4-acetyl-3-methylphenyl) (1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | (4-acetyl-3-methylphenyl) (1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 166245595 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (4-acetyl-3-methylphenyl) (1S,5R)-3-oxabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CC(=O)c1ccc(OC(=O)C2[C@H]3COC[C@@H]23)cc1C |
| InChI | InChI=1S/C15H16O4/c1-8-5-10(3-4-11(8)9(2)16)19-15(17)14-12-6-18-7-13(12)14/h3-5,12-14H,6-7H2,1-2H3/t12-,13+,14? |
| InChIKey | CCPGHXXKAUFYKR-PBWFPOADSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|