C13H14F2N4O5S — CID 166246553
2-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(3-methyltriazol-4-yl)sulfonylacetamide (PubChem CID 166246553) has the molecular formula C13H14F2N4O5S and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(3-methyltriazol-4-yl)sulfonylacetamide.
| Compound Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(3-methyltriazol-4-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 166246553 |
| Molecular Formula | C13H14F2N4O5S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(3-methyltriazol-4-yl)sulfonylacetamide |
| SMILES | COc1ccc(CC(=O)NS(=O)(=O)c2cnnn2C)cc1OC(F)F |
| InChI | InChI=1S/C13H14F2N4O5S/c1-19-12(7-16-18-19)25(21,22)17-11(20)6-8-3-4-9(23-2)10(5-8)24-13(14)15/h3-5,7,13H,6H2,1-2H3,(H,17,20) |
| InChIKey | SDNREXGYWZVOFX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |