C19H22N2O3 — CID 166249060
2-(N-benzylanilino)-N-[(3S,4S)-4-hydroxyoxolan-3-yl]acetamide (PubChem CID 166249060) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-(N-benzylanilino)-N-[(3S,4S)-4-hydroxyoxolan-3-yl]acetamide.
| Compound Name | 2-(N-benzylanilino)-N-[(3S,4S)-4-hydroxyoxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 166249060 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(N-benzylanilino)-N-[(3S,4S)-4-hydroxyoxolan-3-yl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)c1ccccc1)N[C@H]1COC[C@H]1O |
| InChI | InChI=1S/C19H22N2O3/c22-18-14-24-13-17(18)20-19(23)12-21(16-9-5-2-6-10-16)11-15-7-3-1-4-8-15/h1-10,17-18,22H,11-14H2,(H,20,23)/t17-,18+/m0/s1 |
| InChIKey | YBJZSVREBCHSOZ-ZWKOTPCHSA-N |
| XLogP | 1.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |