C13H15FN2O2 — CID 166249858
N-(4-fluorophenyl)-N,3-dimethyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 166249858) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,3-dimethyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N,3-dimethyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166249858 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(4-fluorophenyl)-N,3-dimethyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C(=O)C1(C)CCNC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O2/c1-13(7-8-15-11(13)17)12(18)16(2)10-5-3-9(14)4-6-10/h3-6H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | PEYYBNONLIQNPD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|