C14H16ClNO4S — CID 166249931
(1S,5R)-5-[(5-chloro-2-methylphenyl)sulfonylamino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 166249931) has the molecular formula C14H16ClNO4S and a molecular weight of 329.81 g/mol. Its IUPAC name is (1S,5R)-5-[(5-chloro-2-methylphenyl)sulfonylamino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,5R)-5-[(5-chloro-2-methylphenyl)sulfonylamino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166249931 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (1S,5R)-5-[(5-chloro-2-methylphenyl)sulfonylamino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N[C@H]1C=CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H16ClNO4S/c1-9-5-6-11(15)8-13(9)21(19,20)16-12-4-2-3-10(7-12)14(17)18/h2,4-6,8,10,12,16H,3,7H2,1H3,(H,17,18)/t10-,12-/m0/s1 |
| InChIKey | SQOSUBGWCKCHRF-JQWIXIFHSA-N |
| XLogP | 2.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|