C18H22N6O — CID 166253188
N-[5-cyano-2-(ethylamino)phenyl]-5-(1-methylpyrrolidin-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 166253188) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is N-[5-cyano-2-(ethylamino)phenyl]-5-(1-methylpyrrolidin-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[5-cyano-2-(ethylamino)phenyl]-5-(1-methylpyrrolidin-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166253188 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-[5-cyano-2-(ethylamino)phenyl]-5-(1-methylpyrrolidin-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | CCNc1ccc(C#N)cc1NC(=O)c1cc(C2CCCN2C)[nH]n1 |
| InChI | InChI=1S/C18H22N6O/c1-3-20-13-7-6-12(11-19)9-14(13)21-18(25)16-10-15(22-23-16)17-5-4-8-24(17)2/h6-7,9-10,17,20H,3-5,8H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | IFRWBYGATHQDAM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |